About quinoline-8-selenol
quinoline-8-selenol (PubChem CID 101467585) has the molecular formula C9H7NSe
and a molecular weight of 208.12 g/mol. Its IUPAC name is quinoline-8-selenol.
Molecular Properties
| Compound Name | quinoline-8-selenol |
| PubChem CID | 101467585 |
| Molecular Formula | C9H7NSe |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | quinoline-8-selenol |
| SMILES | [SeH]c1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NSe/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H |
| InChIKey | KPCSMWYUJAOXFN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze quinoline-8-selenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-8-selenol?
The IUPAC name of quinoline-8-selenol (CID 101467585) is quinoline-8-selenol.
What is the SMILES notation for quinoline-8-selenol?
The canonical SMILES for quinoline-8-selenol is [SeH]c1cccc2cccnc12.
What is the InChIKey of quinoline-8-selenol?
The InChIKey is KPCSMWYUJAOXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NSe/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H.
What are the key properties of quinoline-8-selenol?
quinoline-8-selenol has a molecular weight of 208.12 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-8-selenol is sourced from PubChem (CID 101467585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).