C33H23LaN2O9 — CID 139240156
tris(2-carboxyphenolate);lanthanum(3+);1,10-phenanthroline (PubChem CID 139240156) has the molecular formula C33H23LaN2O9 and a molecular weight of 730.46 g/mol. Its IUPAC name is tris(2-carboxyphenolate);lanthanum(3+);1,10-phenanthroline.
| Compound Name | tris(2-carboxyphenolate);lanthanum(3+);1,10-phenanthroline |
|---|---|
| PubChem CID | 139240156 |
| Molecular Formula | C33H23LaN2O9 |
| Molecular Weight | 730.46 g/mol |
| Exact Mass | 730.05 |
| IUPAC Name | tris(2-carboxyphenolate);lanthanum(3+);1,10-phenanthroline |
| SMILES | O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[La+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C7H6O3.La/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*8-6-4-2-1-3-5(6)7(9)10;/h1-8H;3*1-4,8H,(H,9,10);/q;;;;+3/p-3 |
| InChIKey | SXDFFKMMVIUPCR-UHFFFAOYSA-K |
| XLogP | 4.16 |
| TPSA | 206.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|