C19H14N2O3 — CID 54696347
2-carboxyphenolate;1,10-phenanthrolin-10-ium (PubChem CID 54696347) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-carboxyphenolate;1,10-phenanthrolin-10-ium.
| Compound Name | 2-carboxyphenolate;1,10-phenanthrolin-10-ium |
|---|---|
| PubChem CID | 54696347 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-carboxyphenolate;1,10-phenanthrolin-10-ium |
| SMILES | O=C(O)c1ccccc1[O-].c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C7H6O3/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-6-4-2-1-3-5(6)7(9)10/h1-8H;1-4,8H,(H,9,10) |
| InChIKey | BQNVFLJEMFKIED-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|