C16H12N4O2S — CID 139146685
4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate;1,10-phenanthrolin-10-ium (PubChem CID 139146685) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate;1,10-phenanthrolin-10-ium.
| Compound Name | 4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate;1,10-phenanthrolin-10-ium |
|---|---|
| PubChem CID | 139146685 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-oxo-2-sulfanylidene-1H-pyrimidin-6-olate;1,10-phenanthrolin-10-ium |
| SMILES | O=c1cc([O-])[nH]c(=S)[nH]1.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C4H4N2O2S/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;7-2-1-3(8)6-4(9)5-2/h1-8H;1H,(H3,5,6,7,8,9) |
| InChIKey | DLLDRUITZIHOFR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|