C12H8N2S — CID 12830238
1H-1,10-phenanthroline-2-thione (PubChem CID 12830238) has the molecular formula C12H8N2S and a molecular weight of 212.28 g/mol. Its IUPAC name is 1H-1,10-phenanthroline-2-thione.
| Compound Name | 1H-1,10-phenanthroline-2-thione |
|---|---|
| PubChem CID | 12830238 |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1H-1,10-phenanthroline-2-thione |
| SMILES | S=c1ccc2ccc3cccnc3c2[nH]1 |
| InChI | InChI=1S/C12H8N2S/c15-10-6-5-9-4-3-8-2-1-7-13-11(8)12(9)14-10/h1-7H,(H,14,15) |
| InChIKey | OQXCFCDEPHDWRC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|