C18H19N3O7 — CID 139064950
2-[carboxylatomethyl(carboxymethyl)azaniumyl]acetate;1,10-phenanthrolin-10-ium;hydrate (PubChem CID 139064950) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[carboxylatomethyl(carboxymethyl)azaniumyl]acetate;1,10-phenanthrolin-10-ium;hydrate.
| Compound Name | 2-[carboxylatomethyl(carboxymethyl)azaniumyl]acetate;1,10-phenanthrolin-10-ium;hydrate |
|---|---|
| PubChem CID | 139064950 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[carboxylatomethyl(carboxymethyl)azaniumyl]acetate;1,10-phenanthrolin-10-ium;hydrate |
| SMILES | O.O=C([O-])C[NH+](CC(=O)[O-])CC(=O)O.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C6H9NO6.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-8H;1-3H2,(H,8,9)(H,10,11)(H,12,13);1H2 |
| InChIKey | POLQZQYOSKEWQO-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|