palladium;quinoline-8-carboxylic acid

C10H7NO2Pd — CID 174945118

IUPACpalladium;quinoline-8-carboxylic acid
SMILESO=C(O)c1cccc2cccnc12.[Pd]
InChIInChI=1S/C10H7NO2.Pd/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8;/h1-6H,(H,12,13);
InChIKeyOLPYHDDBFBUFRS-UHFFFAOYSA-N
MW279.59 g/mol
LogP1.93
Rot. Bonds1

About palladium;quinoline-8-carboxylic acid

palladium;quinoline-8-carboxylic acid (PubChem CID 174945118) has the molecular formula C10H7NO2Pd and a molecular weight of 279.59 g/mol. Its IUPAC name is palladium;quinoline-8-carboxylic acid.

Molecular Properties

Compound Namepalladium;quinoline-8-carboxylic acid
PubChem CID174945118
Molecular FormulaC10H7NO2Pd
Molecular Weight279.59 g/mol
Exact Mass278.95
IUPAC Namepalladium;quinoline-8-carboxylic acid
SMILESO=C(O)c1cccc2cccnc12.[Pd]
InChIInChI=1S/C10H7NO2.Pd/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8;/h1-6H,(H,12,13);
InChIKeyOLPYHDDBFBUFRS-UHFFFAOYSA-N
XLogP1.93
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.59
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze palladium;quinoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of palladium;quinoline-8-carboxylic acid?
The IUPAC name of palladium;quinoline-8-carboxylic acid (CID 174945118) is palladium;quinoline-8-carboxylic acid.
What is the SMILES notation for palladium;quinoline-8-carboxylic acid?
The canonical SMILES for palladium;quinoline-8-carboxylic acid is O=C(O)c1cccc2cccnc12.[Pd].
What is the InChIKey of palladium;quinoline-8-carboxylic acid?
The InChIKey is OLPYHDDBFBUFRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.Pd/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8;/h1-6H,(H,12,13);.
What are the key properties of palladium;quinoline-8-carboxylic acid?
palladium;quinoline-8-carboxylic acid has a molecular weight of 279.59 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;quinoline-8-carboxylic acid is sourced from PubChem (CID 174945118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).