C20H14EuN2O4 — CID 161453399
benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid (PubChem CID 161453399) has the molecular formula C20H14EuN2O4 and a molecular weight of 498.31 g/mol. Its IUPAC name is benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid.
| Compound Name | benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid |
|---|---|
| PubChem CID | 161453399 |
| Molecular Formula | C20H14EuN2O4 |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2ccc3ccc(C(=O)O)nc3c2n1.[Eu].c1ccccc1 |
| InChI | InChI=1S/C14H8N2O4.C6H6.Eu/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9;1-2-4-6-5-3-1;/h1-6H,(H,17,18)(H,19,20);1-6H; |
| InChIKey | WAVFHLSRSHTDTI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|