benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid

C20H14EuN2O4 — CID 161453399

IUPACbenzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid
SMILESO=C(O)c1ccc2ccc3ccc(C(=O)O)nc3c2n1.[Eu].c1ccccc1
InChIInChI=1S/C14H8N2O4.C6H6.Eu/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9;1-2-4-6-5-3-1;/h1-6H,(H,17,18)(H,19,20);1-6H;
InChIKeyWAVFHLSRSHTDTI-UHFFFAOYSA-N
MW498.31 g/mol
LogP3.87
Rot. Bonds2

About benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid

benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid (PubChem CID 161453399) has the molecular formula C20H14EuN2O4 and a molecular weight of 498.31 g/mol. Its IUPAC name is benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid.

Molecular Properties

Compound Namebenzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid
PubChem CID161453399
Molecular FormulaC20H14EuN2O4
Molecular Weight498.31 g/mol
Exact Mass499.02
IUPAC Namebenzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid
SMILESO=C(O)c1ccc2ccc3ccc(C(=O)O)nc3c2n1.[Eu].c1ccccc1
InChIInChI=1S/C14H8N2O4.C6H6.Eu/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9;1-2-4-6-5-3-1;/h1-6H,(H,17,18)(H,19,20);1-6H;
InChIKeyWAVFHLSRSHTDTI-UHFFFAOYSA-N
XLogP3.87
TPSA100.38 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500498.31
LogP ≤ 53.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid?
The IUPAC name of benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid (CID 161453399) is benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid.
What is the SMILES notation for benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid?
The canonical SMILES for benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid is O=C(O)c1ccc2ccc3ccc(C(=O)O)nc3c2n1.[Eu].c1ccccc1.
What is the InChIKey of benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid?
The InChIKey is WAVFHLSRSHTDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O4.C6H6.Eu/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9;1-2-4-6-5-3-1;/h1-6H,(H,17,18)(H,19,20);1-6H;.
What are the key properties of benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid?
benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid has a molecular weight of 498.31 g/mol, XLogP of 3.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;europium;1,10-phenanthroline-2,9-dicarboxylic acid is sourced from PubChem (CID 161453399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).