About copper;bis(8-hydroxyquinoline-2-carboxylic acid)
copper;bis(8-hydroxyquinoline-2-carboxylic acid) (PubChem CID 172842653) has the molecular formula C20H14CuN2O6
and a molecular weight of 441.89 g/mol. Its IUPAC name is copper;bis(8-hydroxyquinoline-2-carboxylic acid).
Molecular Properties
| Compound Name | copper;bis(8-hydroxyquinoline-2-carboxylic acid) |
| PubChem CID | 172842653 |
| Molecular Formula | C20H14CuN2O6 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | copper;bis(8-hydroxyquinoline-2-carboxylic acid) |
| SMILES | O=C(O)c1ccc2cccc(O)c2n1.O=C(O)c1ccc2cccc(O)c2n1.[Cu] |
| InChI | InChI=1S/2C10H7NO3.Cu/c2*12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;/h2*1-5,12H,(H,13,14); |
| InChIKey | WZSHMRDJYDROAP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper;bis(8-hydroxyquinoline-2-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(8-hydroxyquinoline-2-carboxylic acid)?
The IUPAC name of copper;bis(8-hydroxyquinoline-2-carboxylic acid) (CID 172842653) is copper;bis(8-hydroxyquinoline-2-carboxylic acid).
What is the SMILES notation for copper;bis(8-hydroxyquinoline-2-carboxylic acid)?
The canonical SMILES for copper;bis(8-hydroxyquinoline-2-carboxylic acid) is O=C(O)c1ccc2cccc(O)c2n1.O=C(O)c1ccc2cccc(O)c2n1.[Cu].
What is the InChIKey of copper;bis(8-hydroxyquinoline-2-carboxylic acid)?
The InChIKey is WZSHMRDJYDROAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H7NO3.Cu/c2*12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;/h2*1-5,12H,(H,13,14);.
What are the key properties of copper;bis(8-hydroxyquinoline-2-carboxylic acid)?
copper;bis(8-hydroxyquinoline-2-carboxylic acid) has a molecular weight of 441.89 g/mol, XLogP of 3.27, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(8-hydroxyquinoline-2-carboxylic acid) is sourced from PubChem (CID 172842653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).