About 2-carboxyquinolin-8-olate;methylmercury(1+)
2-carboxyquinolin-8-olate;methylmercury(1+) (PubChem CID 70518723) has the molecular formula C11H9HgNO3
and a molecular weight of 403.79 g/mol. Its IUPAC name is 2-carboxyquinolin-8-olate;methylmercury(1+).
Molecular Properties
| Compound Name | 2-carboxyquinolin-8-olate;methylmercury(1+) |
| PubChem CID | 70518723 |
| Molecular Formula | C11H9HgNO3 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-carboxyquinolin-8-olate;methylmercury(1+) |
| SMILES | C[Hg+].O=C(O)c1ccc2cccc([O-])c2n1 |
| InChI | InChI=1S/C10H7NO3.CH3.Hg/c12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;;/h1-5,12H,(H,13,14);1H3;/q;;+1/p-1 |
| InChIKey | HRYSTIUMWQGHNR-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyquinolin-8-olate;methylmercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyquinolin-8-olate;methylmercury(1+)?
The IUPAC name of 2-carboxyquinolin-8-olate;methylmercury(1+) (CID 70518723) is 2-carboxyquinolin-8-olate;methylmercury(1+).
What is the SMILES notation for 2-carboxyquinolin-8-olate;methylmercury(1+)?
The canonical SMILES for 2-carboxyquinolin-8-olate;methylmercury(1+) is C[Hg+].O=C(O)c1ccc2cccc([O-])c2n1.
What is the InChIKey of 2-carboxyquinolin-8-olate;methylmercury(1+)?
The InChIKey is HRYSTIUMWQGHNR-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H7NO3.CH3.Hg/c12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;;/h1-5,12H,(H,13,14);1H3;/q;;+1/p-1.
What are the key properties of 2-carboxyquinolin-8-olate;methylmercury(1+)?
2-carboxyquinolin-8-olate;methylmercury(1+) has a molecular weight of 403.79 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyquinolin-8-olate;methylmercury(1+) is sourced from PubChem (CID 70518723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).