C13H13BrFN3O2S — CID 103307734
N-(4-bromo-5-fluoro-2-methylphenyl)-3-(methylamino)pyridine-2-sulfonamide (PubChem CID 103307734) has the molecular formula C13H13BrFN3O2S and a molecular weight of 374.24 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-methylphenyl)-3-(methylamino)pyridine-2-sulfonamide.
| Compound Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3-(methylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103307734 |
| Molecular Formula | C13H13BrFN3O2S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3-(methylamino)pyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)Nc1cc(F)c(Br)cc1C |
| InChI | InChI=1S/C13H13BrFN3O2S/c1-8-6-9(14)10(15)7-12(8)18-21(19,20)13-11(16-2)4-3-5-17-13/h3-7,16,18H,1-2H3 |
| InChIKey | RGRCISDPADSVIC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |