C15H19N3O2S — CID 103303080
3-(methylamino)-N-(2,4,6-trimethylphenyl)pyridine-2-sulfonamide (PubChem CID 103303080) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(methylamino)-N-(2,4,6-trimethylphenyl)pyridine-2-sulfonamide.
| Compound Name | 3-(methylamino)-N-(2,4,6-trimethylphenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103303080 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(methylamino)-N-(2,4,6-trimethylphenyl)pyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H19N3O2S/c1-10-8-11(2)14(12(3)9-10)18-21(19,20)15-13(16-4)6-5-7-17-15/h5-9,16,18H,1-4H3 |
| InChIKey | KNHFFEIFKRVCOR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |