C10H11N5O2S — CID 103303450
3-(methylamino)-N-pyrimidin-2-ylpyridine-2-sulfonamide (PubChem CID 103303450) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-(methylamino)-N-pyrimidin-2-ylpyridine-2-sulfonamide.
| Compound Name | 3-(methylamino)-N-pyrimidin-2-ylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103303450 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-(methylamino)-N-pyrimidin-2-ylpyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)Nc1ncccn1 |
| InChI | InChI=1S/C10H11N5O2S/c1-11-8-4-2-5-12-9(8)18(16,17)15-10-13-6-3-7-14-10/h2-7,11H,1H3,(H,13,14,15) |
| InChIKey | REPVPKCNLFVRKX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |