C13H15N3O3S — CID 103303586
N-(4-methoxyphenyl)-3-(methylamino)pyridine-2-sulfonamide (PubChem CID 103303586) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-(methylamino)pyridine-2-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-3-(methylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103303586 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(4-methoxyphenyl)-3-(methylamino)pyridine-2-sulfonamide |
| SMILES | CNc1cccnc1S(=O)(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H15N3O3S/c1-14-12-4-3-9-15-13(12)20(17,18)16-10-5-7-11(19-2)8-6-10/h3-9,14,16H,1-2H3 |
| InChIKey | FTCBECNEMALDMQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |