C15H15N3O3S — CID 53174001
N-(4-methoxyphenyl)-1-methylpyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 53174001) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-methylpyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-1-methylpyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 53174001 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(4-methoxyphenyl)-1-methylpyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cn(C)c3ncccc23)cc1 |
| InChI | InChI=1S/C15H15N3O3S/c1-18-10-14(13-4-3-9-16-15(13)18)22(19,20)17-11-5-7-12(21-2)8-6-11/h3-10,17H,1-2H3 |
| InChIKey | UMDMOIDDUMFJRO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |