C26H20N2O2S — CID 175843270
4-(2-methylphenyl)-N-[2-(2-pyridin-3-ylethynyl)phenyl]benzenesulfonamide (PubChem CID 175843270) has the molecular formula C26H20N2O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 4-(2-methylphenyl)-N-[2-(2-pyridin-3-ylethynyl)phenyl]benzenesulfonamide.
| Compound Name | 4-(2-methylphenyl)-N-[2-(2-pyridin-3-ylethynyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175843270 |
| Molecular Formula | C26H20N2O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-(2-methylphenyl)-N-[2-(2-pyridin-3-ylethynyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccccc1-c1ccc(S(=O)(=O)Nc2ccccc2C#Cc2cccnc2)cc1 |
| InChI | InChI=1S/C26H20N2O2S/c1-20-7-2-4-10-25(20)22-14-16-24(17-15-22)31(29,30)28-26-11-5-3-9-23(26)13-12-21-8-6-18-27-19-21/h2-11,14-19,28H,1H3 |
| InChIKey | YEJXWNPDVDWIGM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|