C22H19NO2S — CID 175468998
3,4-dimethyl-N-[2-(2-phenylethynyl)phenyl]benzenesulfonamide (PubChem CID 175468998) has the molecular formula C22H19NO2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-(2-phenylethynyl)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[2-(2-phenylethynyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175468998 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3,4-dimethyl-N-[2-(2-phenylethynyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2ccccc2)cc1C |
| InChI | InChI=1S/C22H19NO2S/c1-17-12-15-21(16-18(17)2)26(24,25)23-22-11-7-6-10-20(22)14-13-19-8-4-3-5-9-19/h3-12,15-16,23H,1-2H3 |
| InChIKey | AHWHDKHPBIFXGY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|