C16H15NO3S — CID 60813404
N-[2-(3-hydroxyprop-1-ynyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 60813404) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[2-(3-hydroxyprop-1-ynyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60813404 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C#CCO)cc1 |
| InChI | InChI=1S/C16H15NO3S/c1-13-8-10-15(11-9-13)21(19,20)17-16-7-3-2-5-14(16)6-4-12-18/h2-3,5,7-11,17-18H,12H2,1H3 |
| InChIKey | RTKNWISCAHGBKN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|