C25H25NO5S2 — CID 11352175
5-[2-[(4-methylphenyl)sulfonylamino]phenyl]pent-4-ynyl 4-methylbenzenesulfonate (PubChem CID 11352175) has the molecular formula C25H25NO5S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 5-[2-[(4-methylphenyl)sulfonylamino]phenyl]pent-4-ynyl 4-methylbenzenesulfonate.
| Compound Name | 5-[2-[(4-methylphenyl)sulfonylamino]phenyl]pent-4-ynyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11352175 |
| Molecular Formula | C25H25NO5S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 5-[2-[(4-methylphenyl)sulfonylamino]phenyl]pent-4-ynyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C#CCCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5S2/c1-20-11-15-23(16-12-20)32(27,28)26-25-10-6-5-9-22(25)8-4-3-7-19-31-33(29,30)24-17-13-21(2)14-18-24/h5-6,9-18,26H,3,7,19H2,1-2H3 |
| InChIKey | WRHLMBWLCZLEIO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|