C18H18O3S — CID 13204855
4-(4-methylphenyl)but-3-ynyl 4-methylbenzenesulfonate (PubChem CID 13204855) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)but-3-ynyl 4-methylbenzenesulfonate.
| Compound Name | 4-(4-methylphenyl)but-3-ynyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13204855 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(4-methylphenyl)but-3-ynyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C#CCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18O3S/c1-15-6-10-17(11-7-15)5-3-4-14-21-22(19,20)18-12-8-16(2)9-13-18/h6-13H,4,14H2,1-2H3 |
| InChIKey | MOZPOGBKNGHYPJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|