C10H11NO4S — CID 174804599
2-isocyanatoethyl 4-methylbenzenesulfonate (PubChem CID 174804599) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-isocyanatoethyl 4-methylbenzenesulfonate.
| Compound Name | 2-isocyanatoethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174804599 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2-isocyanatoethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN=C=O)cc1 |
| InChI | InChI=1S/C10H11NO4S/c1-9-2-4-10(5-3-9)16(13,14)15-7-6-11-8-12/h2-5H,6-7H2,1H3 |
| InChIKey | BDWWQROVAJFHJX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|