About 3-azidopropyl 4-methylbenzenesulfonate
3-azidopropyl 4-methylbenzenesulfonate (PubChem CID 10753505) has the molecular formula C10H13N3O3S
and a molecular weight of 255.30 g/mol. Its IUPAC name is 3-azidopropyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 3-azidopropyl 4-methylbenzenesulfonate |
| PubChem CID | 10753505 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-azidopropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C10H13N3O3S/c1-9-3-5-10(6-4-9)17(14,15)16-8-2-7-12-13-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | MMGDPHCMLPGJAE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azidopropyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidopropyl 4-methylbenzenesulfonate?
The IUPAC name of 3-azidopropyl 4-methylbenzenesulfonate (CID 10753505) is 3-azidopropyl 4-methylbenzenesulfonate.
What is the SMILES notation for 3-azidopropyl 4-methylbenzenesulfonate?
The canonical SMILES for 3-azidopropyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCN=[N+]=[N-])cc1.
What is the InChIKey of 3-azidopropyl 4-methylbenzenesulfonate?
The InChIKey is MMGDPHCMLPGJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3S/c1-9-3-5-10(6-4-9)17(14,15)16-8-2-7-12-13-11/h3-6H,2,7-8H2,1H3.
What are the key properties of 3-azidopropyl 4-methylbenzenesulfonate?
3-azidopropyl 4-methylbenzenesulfonate has a molecular weight of 255.30 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidopropyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10753505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).