C15H15NO3S2 — CID 61454327
5-ethyl-N-[2-(3-hydroxyprop-1-ynyl)phenyl]thiophene-2-sulfonamide (PubChem CID 61454327) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-ethyl-N-[2-(3-hydroxyprop-1-ynyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-(3-hydroxyprop-1-ynyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61454327 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-ethyl-N-[2-(3-hydroxyprop-1-ynyl)phenyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccccc2C#CCO)s1 |
| InChI | InChI=1S/C15H15NO3S2/c1-2-13-9-10-15(20-13)21(18,19)16-14-8-4-3-6-12(14)7-5-11-17/h3-4,6,8-10,16-17H,2,11H2,1H3 |
| InChIKey | OEXFFHUZYPYOSW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|