C13H16N2O2S2 — CID 64894286
N-[2-(aminomethyl)phenyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 64894286) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[2-(aminomethyl)phenyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[2-(aminomethyl)phenyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 64894286 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[2-(aminomethyl)phenyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccccc2CN)s1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-2-11-7-8-13(18-11)19(16,17)15-12-6-4-3-5-10(12)9-14/h3-8,15H,2,9,14H2,1H3 |
| InChIKey | DXPUPQVXMSQVRN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |