About N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide
N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide (PubChem CID 104757226) has the molecular formula C14H18N2O2S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide |
| PubChem CID | 104757226 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(N)c(C)cc2C)s1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-4-11-5-6-14(19-11)20(17,18)16-13-8-12(15)9(2)7-10(13)3/h5-8,16H,4,15H2,1-3H3 |
| InChIKey | WUCHWLWZGYVYGI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide?
The IUPAC name of N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide (CID 104757226) is N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide.
What is the SMILES notation for N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide?
The canonical SMILES for N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide is CCc1ccc(S(=O)(=O)Nc2cc(N)c(C)cc2C)s1.
What is the InChIKey of N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide?
The InChIKey is WUCHWLWZGYVYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S2/c1-4-11-5-6-14(19-11)20(17,18)16-13-8-12(15)9(2)7-10(13)3/h5-8,16H,4,15H2,1-3H3.
What are the key properties of N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide?
N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide has a molecular weight of 310.44 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-2,4-dimethylphenyl)-5-ethylthiophene-2-sulfonamide is sourced from PubChem (CID 104757226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).