C10H10N2O2 — CID 60803594
[2-(3-hydroxyprop-1-ynyl)phenyl]urea (PubChem CID 60803594) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is [2-(3-hydroxyprop-1-ynyl)phenyl]urea.
| Compound Name | [2-(3-hydroxyprop-1-ynyl)phenyl]urea |
|---|---|
| PubChem CID | 60803594 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | [2-(3-hydroxyprop-1-ynyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1C#CCO |
| InChI | InChI=1S/C10H10N2O2/c11-10(14)12-9-6-2-1-4-8(9)5-3-7-13/h1-2,4,6,13H,7H2,(H3,11,12,14) |
| InChIKey | RKHQWFHJZHPXIW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|