C13H11N3O2 — CID 63080851
N-[2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 63080851) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-[2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63080851 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1C#CCO)c1cn[nH]c1 |
| InChI | InChI=1S/C13H11N3O2/c17-7-3-5-10-4-1-2-6-12(10)16-13(18)11-8-14-15-9-11/h1-2,4,6,8-9,17H,7H2,(H,14,15)(H,16,18) |
| InChIKey | BCMURIZRWSEKMR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|