C12H13NO2 — CID 60800142
N-[2-(3-hydroxyprop-1-ynyl)phenyl]propanamide (PubChem CID 60800142) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-[2-(3-hydroxyprop-1-ynyl)phenyl]propanamide.
| Compound Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 60800142 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-[2-(3-hydroxyprop-1-ynyl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccccc1C#CCO |
| InChI | InChI=1S/C12H13NO2/c1-2-12(15)13-11-8-4-3-6-10(11)7-5-9-14/h3-4,6,8,14H,2,9H2,1H3,(H,13,15) |
| InChIKey | RUZAOUMQGSSOHF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|