C12H16N2OSi — CID 11299239
[2-(2-trimethylsilylethynyl)phenyl]urea (PubChem CID 11299239) has the molecular formula C12H16N2OSi and a molecular weight of 232.36 g/mol. Its IUPAC name is [2-(2-trimethylsilylethynyl)phenyl]urea.
| Compound Name | [2-(2-trimethylsilylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 11299239 |
| Molecular Formula | C12H16N2OSi |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | [2-(2-trimethylsilylethynyl)phenyl]urea |
| SMILES | C[Si](C)(C)C#Cc1ccccc1NC(N)=O |
| InChI | InChI=1S/C12H16N2OSi/c1-16(2,3)9-8-10-6-4-5-7-11(10)14-12(13)15/h4-7H,1-3H3,(H3,13,14,15) |
| InChIKey | WHPQUQHKLWDTDL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|