C29H36N2O4Si — CID 135012268
tert-butyl N-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethynyl]-2-(2-trimethylsilylethynyl)phenyl]carbamate (PubChem CID 135012268) has the molecular formula C29H36N2O4Si and a molecular weight of 504.70 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethynyl]-2-(2-trimethylsilylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethynyl]-2-(2-trimethylsilylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 135012268 |
| Molecular Formula | C29H36N2O4Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | tert-butyl N-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethynyl]-2-(2-trimethylsilylethynyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1C#Cc1ccc(C#C[Si](C)(C)C)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C29H36N2O4Si/c1-28(2,3)34-26(32)30-24-13-11-10-12-22(24)16-14-21-15-17-23(18-19-36(7,8)9)25(20-21)31-27(33)35-29(4,5)6/h10-13,15,17,20H,1-9H3,(H,30,32)(H,31,33) |
| InChIKey | USWOEDLBPRYYPL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|