C18H27NO2Si — CID 160683240
tert-butyl N-[2,4-dimethyl-3-(2-trimethylsilylethynyl)phenyl]carbamate (PubChem CID 160683240) has the molecular formula C18H27NO2Si and a molecular weight of 317.51 g/mol. Its IUPAC name is tert-butyl N-[2,4-dimethyl-3-(2-trimethylsilylethynyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2,4-dimethyl-3-(2-trimethylsilylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 160683240 |
| Molecular Formula | C18H27NO2Si |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | tert-butyl N-[2,4-dimethyl-3-(2-trimethylsilylethynyl)phenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OC(C)(C)C)c(C)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H27NO2Si/c1-13-9-10-16(19-17(20)21-18(3,4)5)14(2)15(13)11-12-22(6,7)8/h9-10H,1-8H3,(H,19,20) |
| InChIKey | SBRQUXKPRHGIRP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|