C13H15F2NO2Si — CID 131872723
methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate (PubChem CID 131872723) has the molecular formula C13H15F2NO2Si and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate.
| Compound Name | methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 131872723 |
| Molecular Formula | C13H15F2NO2Si |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(F)c(F)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H15F2NO2Si/c1-18-13(17)16-11-6-5-10(14)12(15)9(11)7-8-19(2,3)4/h5-6H,1-4H3,(H,16,17) |
| InChIKey | PJARSBVSZYUBQH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|