About methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate
methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate (PubChem CID 131872723) has the molecular formula C13H15F2NO2Si
and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate |
| PubChem CID | 131872723 |
| Molecular Formula | C13H15F2NO2Si |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(F)c(F)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H15F2NO2Si/c1-18-13(17)16-11-6-5-10(14)12(15)9(11)7-8-19(2,3)4/h5-6H,1-4H3,(H,16,17) |
| InChIKey | PJARSBVSZYUBQH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate?
The IUPAC name of methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate (CID 131872723) is methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate.
What is the SMILES notation for methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate?
The canonical SMILES for methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate is COC(=O)Nc1ccc(F)c(F)c1C#C[Si](C)(C)C.
What is the InChIKey of methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate?
The InChIKey is PJARSBVSZYUBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2Si/c1-18-13(17)16-11-6-5-10(14)12(15)9(11)7-8-19(2,3)4/h5-6H,1-4H3,(H,16,17).
What are the key properties of methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate?
methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate has a molecular weight of 283.35 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3,4-difluoro-2-(2-trimethylsilylethynyl)phenyl]carbamate is sourced from PubChem (CID 131872723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).