C16H18F4Si2 — CID 145191695
trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane (PubChem CID 145191695) has the molecular formula C16H18F4Si2 and a molecular weight of 342.48 g/mol. Its IUPAC name is trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 145191695 |
| Molecular Formula | C16H18F4Si2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1c(F)c(F)c(C#C[Si](C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H18F4Si2/c1-21(2,3)9-7-11-13(17)15(19)12(16(20)14(11)18)8-10-22(4,5)6/h1-6H3 |
| InChIKey | ZFWWRDMCFIMYRP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|