C26H33F4IO4Si2 — CID 159146471
2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl-trimethylsilane;2,4-difluoro-3-iodo-1,5-dimethoxybenzene;ethynyl(trimethyl)silane (PubChem CID 159146471) has the molecular formula C26H33F4IO4Si2 and a molecular weight of 668.61 g/mol. Its IUPAC name is 2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl-trimethylsilane;2,4-difluoro-3-iodo-1,5-dimethoxybenzene;ethynyl(trimethyl)silane.
| Compound Name | 2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl-trimethylsilane;2,4-difluoro-3-iodo-1,5-dimethoxybenzene;ethynyl(trimethyl)silane |
|---|---|
| PubChem CID | 159146471 |
| Molecular Formula | C26H33F4IO4Si2 |
| Molecular Weight | 668.61 g/mol |
| Exact Mass | 668.09 |
| IUPAC Name | 2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl-trimethylsilane;2,4-difluoro-3-iodo-1,5-dimethoxybenzene;ethynyl(trimethyl)silane |
| SMILES | C#C[Si](C)(C)C.COc1cc(OC)c(F)c(C#C[Si](C)(C)C)c1F.COc1cc(OC)c(F)c(I)c1F |
| InChI | InChI=1S/C13H16F2O2Si.C8H7F2IO2.C5H10Si/c1-16-10-8-11(17-2)13(15)9(12(10)14)6-7-18(3,4)5;1-12-4-3-5(13-2)7(10)8(11)6(4)9;1-5-6(2,3)4/h8H,1-5H3;3H,1-2H3;1H,2-4H3 |
| InChIKey | KISYWRYKWRKABQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|