C28H41IN4O6Si2 — CID 159063729
ethyl 5-amino-6-iodo-3-methoxypyridine-2-carboxylate;ethyl 5-amino-3-methoxy-6-(2-trimethylsilylethynyl)pyridine-2-carboxylate;ethynyl(trimethyl)silane (PubChem CID 159063729) has the molecular formula C28H41IN4O6Si2 and a molecular weight of 712.73 g/mol. Its IUPAC name is ethyl 5-amino-6-iodo-3-methoxypyridine-2-carboxylate;ethyl 5-amino-3-methoxy-6-(2-trimethylsilylethynyl)pyridine-2-carboxylate;ethynyl(trimethyl)silane.
| Compound Name | ethyl 5-amino-6-iodo-3-methoxypyridine-2-carboxylate;ethyl 5-amino-3-methoxy-6-(2-trimethylsilylethynyl)pyridine-2-carboxylate;ethynyl(trimethyl)silane |
|---|---|
| PubChem CID | 159063729 |
| Molecular Formula | C28H41IN4O6Si2 |
| Molecular Weight | 712.73 g/mol |
| Exact Mass | 712.16 |
| IUPAC Name | ethyl 5-amino-6-iodo-3-methoxypyridine-2-carboxylate;ethyl 5-amino-3-methoxy-6-(2-trimethylsilylethynyl)pyridine-2-carboxylate;ethynyl(trimethyl)silane |
| SMILES | C#C[Si](C)(C)C.CCOC(=O)c1nc(C#C[Si](C)(C)C)c(N)cc1OC.CCOC(=O)c1nc(I)c(N)cc1OC |
| InChI | InChI=1S/C14H20N2O3Si.C9H11IN2O3.C5H10Si/c1-6-19-14(17)13-12(18-2)9-10(15)11(16-13)7-8-20(3,4)5;1-3-15-9(13)7-6(14-2)4-5(11)8(10)12-7;1-5-6(2,3)4/h9H,6,15H2,1-5H3;4H,3,11H2,1-2H3;1H,2-4H3 |
| InChIKey | JYUFETPQADFVMO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 148.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|