C18H25NO2Si2 — CID 155292927
ethyl 2,6-bis(2-trimethylsilylethynyl)pyridine-4-carboxylate (PubChem CID 155292927) has the molecular formula C18H25NO2Si2 and a molecular weight of 343.58 g/mol. Its IUPAC name is ethyl 2,6-bis(2-trimethylsilylethynyl)pyridine-4-carboxylate.
| Compound Name | ethyl 2,6-bis(2-trimethylsilylethynyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 155292927 |
| Molecular Formula | C18H25NO2Si2 |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 2,6-bis(2-trimethylsilylethynyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(C#C[Si](C)(C)C)nc(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H25NO2Si2/c1-8-21-18(20)15-13-16(9-11-22(2,3)4)19-17(14-15)10-12-23(5,6)7/h13-14H,8H2,1-7H3 |
| InChIKey | OSHYRIZJIUVQBW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|