C16H19N3O2Si — CID 169401350
ethyl 5-[3-(2-trimethylsilylethynyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401350) has the molecular formula C16H19N3O2Si and a molecular weight of 313.43 g/mol. Its IUPAC name is ethyl 5-[3-(2-trimethylsilylethynyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(2-trimethylsilylethynyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401350 |
| Molecular Formula | C16H19N3O2Si |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 5-[3-(2-trimethylsilylethynyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H19N3O2Si/c1-5-21-16(20)15-14(17-19-18-15)13-8-6-7-12(11-13)9-10-22(2,3)4/h6-8,11H,5H2,1-4H3,(H,17,18,19) |
| InChIKey | VFRAEGGPUDLNAV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|