C22H23N3O6 — CID 169401641
ethyl 5-[3-[3-(4-methoxycarbonylphenoxy)propoxy]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401641) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl 5-[3-[3-(4-methoxycarbonylphenoxy)propoxy]phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-[3-(4-methoxycarbonylphenoxy)propoxy]phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401641 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 5-[3-[3-(4-methoxycarbonylphenoxy)propoxy]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(OCCCOc2ccc(C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C22H23N3O6/c1-3-29-22(27)20-19(23-25-24-20)16-6-4-7-18(14-16)31-13-5-12-30-17-10-8-15(9-11-17)21(26)28-2/h4,6-11,14H,3,5,12-13H2,1-2H3,(H,23,24,25) |
| InChIKey | CPSJSHJYLCCSQZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|