C16H13N3O5 — CID 169400748
ethyl 5-[3-(furan-2-carbonyloxy)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400748) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is ethyl 5-[3-(furan-2-carbonyloxy)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(furan-2-carbonyloxy)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400748 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethyl 5-[3-(furan-2-carbonyloxy)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(OC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H13N3O5/c1-2-22-16(21)14-13(17-19-18-14)10-5-3-6-11(9-10)24-15(20)12-7-4-8-23-12/h3-9H,2H2,1H3,(H,17,18,19) |
| InChIKey | ONERACCOLSMTMQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|