C18H16FN3O3 — CID 169400053
ethyl 5-[3-(3-fluoro-4-methoxyphenyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400053) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is ethyl 5-[3-(3-fluoro-4-methoxyphenyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(3-fluoro-4-methoxyphenyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400053 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl 5-[3-(3-fluoro-4-methoxyphenyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(-c2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C18H16FN3O3/c1-3-25-18(23)17-16(20-22-21-17)13-6-4-5-11(9-13)12-7-8-15(24-2)14(19)10-12/h4-10H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | RPPNHCYUMGQVSQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |