C22H29F2IN2Si2 — CID 159717629
ethynyl(trimethyl)silane;4-fluoro-2-iodoaniline;4-fluoro-2-(2-trimethylsilylethynyl)aniline (PubChem CID 159717629) has the molecular formula C22H29F2IN2Si2 and a molecular weight of 542.56 g/mol. Its IUPAC name is ethynyl(trimethyl)silane;4-fluoro-2-iodoaniline;4-fluoro-2-(2-trimethylsilylethynyl)aniline.
| Compound Name | ethynyl(trimethyl)silane;4-fluoro-2-iodoaniline;4-fluoro-2-(2-trimethylsilylethynyl)aniline |
|---|---|
| PubChem CID | 159717629 |
| Molecular Formula | C22H29F2IN2Si2 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | ethynyl(trimethyl)silane;4-fluoro-2-iodoaniline;4-fluoro-2-(2-trimethylsilylethynyl)aniline |
| SMILES | C#C[Si](C)(C)C.C[Si](C)(C)C#Cc1cc(F)ccc1N.Nc1ccc(F)cc1I |
| InChI | InChI=1S/C11H14FNSi.C6H5FIN.C5H10Si/c1-14(2,3)7-6-9-8-10(12)4-5-11(9)13;7-4-1-2-6(9)5(8)3-4;1-5-6(2,3)4/h4-5,8H,13H2,1-3H3;1-3H,9H2;1H,2-4H3 |
| InChIKey | MZQAJTRQFJXAKJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|