C17H17F2NSi — CID 131747401
3-(2,4-difluorophenyl)-5-(2-trimethylsilylethynyl)aniline (PubChem CID 131747401) has the molecular formula C17H17F2NSi and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-5-(2-trimethylsilylethynyl)aniline.
| Compound Name | 3-(2,4-difluorophenyl)-5-(2-trimethylsilylethynyl)aniline |
|---|---|
| PubChem CID | 131747401 |
| Molecular Formula | C17H17F2NSi |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)-5-(2-trimethylsilylethynyl)aniline |
| SMILES | C[Si](C)(C)C#Cc1cc(N)cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H17F2NSi/c1-21(2,3)7-6-12-8-13(10-15(20)9-12)16-5-4-14(18)11-17(16)19/h4-5,8-11H,20H2,1-3H3 |
| InChIKey | XYMZQXQQCZVAON-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|