C12H8F2O2 — CID 171771394
5-(2,4-difluorophenyl)benzene-1,3-diol (PubChem CID 171771394) has the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)benzene-1,3-diol.
| Compound Name | 5-(2,4-difluorophenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 171771394 |
| Molecular Formula | C12H8F2O2 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-(2,4-difluorophenyl)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C12H8F2O2/c13-8-1-2-11(12(14)5-8)7-3-9(15)6-10(16)4-7/h1-6,15-16H |
| InChIKey | IOADNQBKCXPTDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |