C12H8F2S — CID 142871981
4-(2,4-difluorophenyl)benzenethiol (PubChem CID 142871981) has the molecular formula C12H8F2S and a molecular weight of 222.26 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)benzenethiol.
| Compound Name | 4-(2,4-difluorophenyl)benzenethiol |
|---|---|
| PubChem CID | 142871981 |
| Molecular Formula | C12H8F2S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 4-(2,4-difluorophenyl)benzenethiol |
| SMILES | Fc1ccc(-c2ccc(S)cc2)c(F)c1 |
| InChI | InChI=1S/C12H8F2S/c13-9-3-6-11(12(14)7-9)8-1-4-10(15)5-2-8/h1-7,15H |
| InChIKey | RZMWSJDJTMAUKC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|