C13H7F2NS — CID 67074742
5-(2,4-difluorophenyl)-2-sulfanylbenzonitrile (PubChem CID 67074742) has the molecular formula C13H7F2NS and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-sulfanylbenzonitrile.
| Compound Name | 5-(2,4-difluorophenyl)-2-sulfanylbenzonitrile |
|---|---|
| PubChem CID | 67074742 |
| Molecular Formula | C13H7F2NS |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-sulfanylbenzonitrile |
| SMILES | N#Cc1cc(-c2ccc(F)cc2F)ccc1S |
| InChI | InChI=1S/C13H7F2NS/c14-10-2-3-11(12(15)6-10)8-1-4-13(17)9(5-8)7-16/h1-6,17H |
| InChIKey | YQOHJVNQBVSETA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|