C13H6BrF2N — CID 171663295
3-bromo-5-(2,4-difluorophenyl)benzonitrile (PubChem CID 171663295) has the molecular formula C13H6BrF2N and a molecular weight of 294.10 g/mol. Its IUPAC name is 3-bromo-5-(2,4-difluorophenyl)benzonitrile.
| Compound Name | 3-bromo-5-(2,4-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 171663295 |
| Molecular Formula | C13H6BrF2N |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 3-bromo-5-(2,4-difluorophenyl)benzonitrile |
| SMILES | N#Cc1cc(Br)cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H6BrF2N/c14-10-4-8(7-17)3-9(5-10)12-2-1-11(15)6-13(12)16/h1-6H |
| InChIKey | LODDZDINRCBGTR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |