C13H6ClF2N — CID 172914923
4-chloro-3-(2,4-difluorophenyl)benzonitrile (PubChem CID 172914923) has the molecular formula C13H6ClF2N and a molecular weight of 249.65 g/mol. Its IUPAC name is 4-chloro-3-(2,4-difluorophenyl)benzonitrile.
| Compound Name | 4-chloro-3-(2,4-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 172914923 |
| Molecular Formula | C13H6ClF2N |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 4-chloro-3-(2,4-difluorophenyl)benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H6ClF2N/c14-12-4-1-8(7-17)5-11(12)10-3-2-9(15)6-13(10)16/h1-6H |
| InChIKey | FJUIICYQLXGICV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |