C13H6F3N — CID 172989811
2-(2,4-difluorophenyl)-4-fluorobenzonitrile (PubChem CID 172989811) has the molecular formula C13H6F3N and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-fluorobenzonitrile.
| Compound Name | 2-(2,4-difluorophenyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 172989811 |
| Molecular Formula | C13H6F3N |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C13H6F3N/c14-9-2-1-8(7-17)12(5-9)11-4-3-10(15)6-13(11)16/h1-6H |
| InChIKey | XZVOJOVZBKTOIP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |