C13H3Cl5FN — CID 134630053
4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)benzonitrile (PubChem CID 134630053) has the molecular formula C13H3Cl5FN and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)benzonitrile.
| Compound Name | 4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)benzonitrile |
|---|---|
| PubChem CID | 134630053 |
| Molecular Formula | C13H3Cl5FN |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 366.87 |
| IUPAC Name | 4-fluoro-2-(2,3,4,5,6-pentachlorophenyl)benzonitrile |
| SMILES | N#Cc1ccc(F)cc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H3Cl5FN/c14-9-8(10(15)12(17)13(18)11(9)16)7-3-6(19)2-1-5(7)4-20/h1-3H |
| InChIKey | JNSAOLALAVMFTQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|