C7H2ClF2N — CID 67940983
4-chloro-2,3-difluorobenzonitrile (PubChem CID 67940983) has the molecular formula C7H2ClF2N and a molecular weight of 173.55 g/mol. Its IUPAC name is 4-chloro-2,3-difluorobenzonitrile.
| Compound Name | 4-chloro-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 67940983 |
| Molecular Formula | C7H2ClF2N |
| Molecular Weight | 173.55 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 4-chloro-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)c(F)c1F |
| InChI | InChI=1S/C7H2ClF2N/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2H |
| InChIKey | RMXBPYPAXHFJKB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|